tert-Butyl lithioacetate
Modify Date: 2026-07-16 10:56:29
tert-Butyl lithioacetate structure
|
Common Name | tert-Butyl lithioacetate | ||
|---|---|---|---|---|
| CAS Number | 53503-61-0 | Molecular Weight | 122.1 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C6H11LiO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | tert-Butyl lithioacetate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C6H11LiO2 |
|---|---|
| Molecular Weight | 122.1 |
| InChIKey | BICHUHFOYHUQIC-UHFFFAOYSA-N |
| SMILES | [CH2-]C(=O)OC(C)(C)C.[Li+] |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of tert-Butyl lithioacetate? |
| A: CAS number of tert-Butyl lithioacetate is 53503-61-0. |
| Q: What is the molecular weight of tert-Butyl lithioacetate? |
| A: Molecular weight of tert-Butyl lithioacetate is 122.1. |
| Q: What is the InChIKey of tert-Butyl lithioacetate? |
| A: InChIKey of tert-Butyl lithioacetate is BICHUHFOYHUQIC-UHFFFAOYSA-N. |
| Q: What is the English name of tert-Butyl lithioacetate? |
| A: The English name of tert-Butyl lithioacetate is tert-Butyl lithioacetate. |
| Q: What is the SMILES notation of tert-Butyl lithioacetate? |
| A: SMILES notation of tert-Butyl lithioacetate is [CH2-]C(=O)OC(C)(C)C.[Li+]. |
| Q: What is the Chinese name of 53503-61-0? |
| A: Chinese name of 53503-61-0 is 53503-61-0. |
| Q: What is the molecular formula of tert-Butyl lithioacetate? |
| A: Molecular formula of tert-Butyl lithioacetate is C6H11LiO2. |