2,3,4,5,6-Pentafluorobenzyl chloroformate structure
|
Common Name | 2,3,4,5,6-Pentafluorobenzyl chloroformate | ||
|---|---|---|---|---|
| CAS Number | 53526-74-2 | Molecular Weight | 260.54500 | |
| Density | 1.647g/cm3 | Boiling Point | 208.7ºC at 760mmHg | |
| Molecular Formula | C8H2ClF5O2 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 79.6ºC | |
| Name | 2,3,4,5,6-Pentafluorobenzyl chloroformate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.647g/cm3 |
|---|---|
| Boiling Point | 208.7ºC at 760mmHg |
| Molecular Formula | C8H2ClF5O2 |
| Molecular Weight | 260.54500 |
| Flash Point | 79.6ºC |
| Exact Mass | 259.96600 |
| PSA | 26.30000 |
| LogP | 3.25750 |
| Index of Refraction | 1.444 |
| InChIKey | CAKTVARYLWEKSA-UHFFFAOYSA-N |
| SMILES | O=C(Cl)OCc1c(F)c(F)c(F)c(F)c1F |
| Hazard Codes | Xi,T,C |
|---|---|
| Risk Phrases | 36/37/38 |
| Safety Phrases | 3/7-9-23-36/37/39 |
| HS Code | 2915900090 |
|
~%
2,3,4,5,6-Penta... CAS#:53526-74-2 |
| Literature: Bulletin of the Academy of Sciences of the USSR, Division of Chemical Science (English Translation), , vol. 38, # 7.2 p. 1555 - 1557 Izvestiya Akademii Nauk SSSR, Seriya Khimicheskaya, , vol. 38, # 7 p. 1694 - 1696 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2915900090 |
|---|---|
| Summary | 2915900090 other saturated acyclic monocarboxylic acids and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:5.5% General tariff:30.0% |
| (2,3,4,5,6-pentafluorophenyl)methyl carbonochloridate |