Methyl 2-chloro-3-nitrobenzoate structure
|
Common Name | Methyl 2-chloro-3-nitrobenzoate | ||
|---|---|---|---|---|
| CAS Number | 53553-14-3 | Molecular Weight | 215.590 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 319.5±22.0 °C at 760 mmHg | |
| Molecular Formula | C8H6ClNO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 147.0±22.3 °C | |
| Name | methyl 2-chloro-3-nitrobenzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 319.5±22.0 °C at 760 mmHg |
| Molecular Formula | C8H6ClNO4 |
| Molecular Weight | 215.590 |
| Flash Point | 147.0±22.3 °C |
| Exact Mass | 214.998535 |
| PSA | 72.12000 |
| LogP | 1.90 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.568 |
| InChIKey | JBCQPBVZKBEHNF-UHFFFAOYSA-N |
| SMILES | COC(=O)c1cccc([N+](=O)[O-])c1Cl |
| HS Code | 2916399090 |
|---|
|
~98%
Methyl 2-chloro... CAS#:53553-14-3 |
| Literature: TAKEDA PHARMACEUTICAL COMPANY LIMITED Patent: WO2008/51533 A2, 2008 ; Location in patent: Page/Page column 95 ; WO 2008/051533 A2 |
|
~98%
Methyl 2-chloro... CAS#:53553-14-3 |
| Literature: Chugai Seiyaku Kabushiki Kaisha; Sakai, Toshiyuki Patent: EP2172198 A1, 2010 ; |
|
~%
Methyl 2-chloro... CAS#:53553-14-3 |
| Literature: Sugen. Inc. Patent: US2003/100555 A1, 2003 ; US 20030100555 A1 |
|
~%
Methyl 2-chloro... CAS#:53553-14-3 |
| Literature: SCHERING CORPORATION Patent: WO2009/58728 A1, 2009 ; Location in patent: Page/Page column 86 ; WO 2009/058728 A1 |
|
~50%
Methyl 2-chloro... CAS#:53553-14-3 |
| Literature: Eli Lilly and Company Patent: US6177440 B1, 2001 ; |
|
~%
Methyl 2-chloro... CAS#:53553-14-3 |
| Literature: Hoechst Schering AgrEvo GmbH Patent: US5658854 A1, 1997 ; |
|
~%
Methyl 2-chloro... CAS#:53553-14-3 |
| Literature: TAKEDA PHARMACEUTICAL COMPANY LIMITED Patent: WO2006/116412 A2, 2006 ; Location in patent: Page/Page column 79; 80; 95 ; WO 2006/116412 A2 |
| Precursor 8 | |
|---|---|
| DownStream 10 | |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 2-Chloro-3-methoxybenzoic acid methyl ester |
| 2-Chlor-3-nitro-benzoesaeure-methylester |
| Benzoic acid, 2-chloro-3-nitro-, methyl ester |
| 2-chloro-3-nitrobenzoic acid methyl ester |
| 2-chloro-3-methoxycarbonyl-nitrobenzene |
| 2-Chlor-3-methoxybenzoesaeuremethylester |
| Methyl 2-chloro-3-nitrobenzoate |
| Benzoic acid,2-chloro-3-methoxy-,methyl ester |