bis(4-bromophenyl)iodanium,chloride
Modify Date: 2025-09-26 20:29:22
bis(4-bromophenyl)iodanium,chloride structure
|
Common Name | bis(4-bromophenyl)iodanium,chloride | ||
|---|---|---|---|---|
| CAS Number | 53601-22-2 | Molecular Weight | 474.35700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H8Br2ClI | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | bis(4-bromophenyl)iodanium,chloride |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H8Br2ClI |
|---|---|
| Molecular Weight | 474.35700 |
| Exact Mass | 471.77300 |
| InChIKey | URAPXKOLSGVWBU-UHFFFAOYSA-M |
| SMILES | Brc1ccc([I+]c2ccc(Br)cc2)cc1.[Cl-] |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 9 | |
CAS#:147217-71-8
CAS#:28969-28-0
CAS#:2050-47-7
CAS#:589-87-7
CAS#:586-76-5
CAS#:637-87-6
CAS#:121900-07-0
CAS#:41318-75-6
CAS#:5575-51-9This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of bis(4-bromophenyl)iodanium,chloride? |
| A: The English name of bis(4-bromophenyl)iodanium,chloride is bis(4-bromophenyl)iodanium,chloride. |
| Q: What is the SMILES notation of bis(4-bromophenyl)iodanium,chloride? |
| A: SMILES notation of bis(4-bromophenyl)iodanium,chloride is Brc1ccc([I+]c2ccc(Br)cc2)cc1.[Cl-]. |
| Q: What is the InChIKey of bis(4-bromophenyl)iodanium,chloride? |
| A: InChIKey of bis(4-bromophenyl)iodanium,chloride is URAPXKOLSGVWBU-UHFFFAOYSA-M. |
| Q: What is the Chinese name of 53601-22-2? |
| A: Chinese name of 53601-22-2 is 53601-22-2. |
| Q: What is the molecular weight of bis(4-bromophenyl)iodanium,chloride? |
| A: Molecular weight of bis(4-bromophenyl)iodanium,chloride is 474.35700. |
| Q: What is the molecular formula of bis(4-bromophenyl)iodanium,chloride? |
| A: Molecular formula of bis(4-bromophenyl)iodanium,chloride is C12H8Br2ClI. |
| Q: What is the CAS number of bis(4-bromophenyl)iodanium,chloride? |
| A: CAS number of bis(4-bromophenyl)iodanium,chloride is 53601-22-2. |
| Q: What are the downstream products of bis(4-bromophenyl)iodanium,chloride? |
| A: Related downstream products(CAS) of bis(4-bromophenyl)iodanium,chloride: 147217-71-8;28969-28-0;2050-47-7;589-87-7;586-76-5;637-87-6;121900-07-0;41318-75-6;5575-51-9. |