4,4'-Oxybis(bromobenzene) structure
|
Common Name | 4,4'-Oxybis(bromobenzene) | ||
|---|---|---|---|---|
| CAS Number | 2050-47-7 | Molecular Weight | 327.999 | |
| Density | 1.7±0.1 g/cm3 | Boiling Point | 339.0±0.0 °C at 760 mmHg | |
| Molecular Formula | C12H8Br2O | Melting Point | 61-63 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 140.3±19.4 °C | |
| Symbol |
GHS02, GHS07, GHS08, GHS09 |
Signal Word | Danger | |
| Name | 1-bromo-4-(4-bromophenoxy)benzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.7±0.1 g/cm3 |
|---|---|
| Boiling Point | 339.0±0.0 °C at 760 mmHg |
| Melting Point | 61-63 °C(lit.) |
| Molecular Formula | C12H8Br2O |
| Molecular Weight | 327.999 |
| Flash Point | 140.3±19.4 °C |
| Exact Mass | 325.894165 |
| PSA | 9.23000 |
| LogP | 6.01 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.626 |
| InChIKey | YAWIAFUBXXPJMQ-UHFFFAOYSA-N |
| SMILES | Brc1ccc(Oc2ccc(Br)cc2)cc1 |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Symbol |
GHS02, GHS07, GHS08, GHS09 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H225-H304-H315-H336-H410 |
| Precautionary Statements | P210-P261-P273-P301 + P310-P331-P501 |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
| Hazard Codes | F;Xn;N |
| Risk Phrases | R33 |
| Safety Phrases | S24/25-S62-S61-S60 |
| RIDADR | UN 1262 3/PG 2 |
| WGK Germany | 3 |
| RTECS | KN0175000 |
| HS Code | 2903999090 |
| Precursor 10 | |
|---|---|
| DownStream 10 | |
| HS Code | 2903999090 |
|---|---|
| Summary | 2903999090 halogenated derivatives of aromatic hydrocarbons VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
|
Synthesis and characterization of a new bisphosphonic acid and several metal hybrids derivatives.
Inorg. Chem. 43(17) , 5283-93, (2004) Commercial bis-(4-bromophenyl)-ether, [BrC(6)H(4)](2)-O, has been used to prepare 4-[4'-(diethoxyphosphoryl)phenoxy]phenyl-phosphonic acid diethyl ester, [(CH(3)CH(2))(2)O(3)P-C(6)H(4)](2)-O, (I) foll... |
| 4,4'-Dibromodiphenyl ether |
| di(4-Bromophenyl)ether |
| para-bromophenyl ether |
| ETHER,BIS(4-BROMOPHENYL) |
| Ether,bis(p-bromophenyl) |
| 4,4'-DiBDE |
| p,p'-Dibromodiphenyl ether |
| Benzene, 1,1'-oxybis[4-bromo- |
| 4,4'-oxybis(bromobenzene) |
| Ether, bis(p-bromophenyl) (8CI) |
| USAF DO-61 |
| MFCD00000095 |
| Bis(4-bromophenyl) ether |
| 1,1'-Oxybis(4-bromobenzene) |
| Bis-(4-bromophenyl)-ether |
| 4-Bromophenyl ether |
| Bis(p-bromophenyl) ether |
| Phenyl ether, 4-bromo- |
| EINECS 218-090-7 |