1,1,1,2,2,3,3,4,4,7,7,8,8,9,9,10,10,10-octadecafluoro-5-iododecane structure
|
Common Name | 1,1,1,2,2,3,3,4,4,7,7,8,8,9,9,10,10,10-octadecafluoro-5-iododecane | ||
|---|---|---|---|---|
| CAS Number | 53638-10-1 | Molecular Weight | 592.00700 | |
| Density | 1.902g/cm3 | Boiling Point | 85-85,5ºC 25mm | |
| Molecular Formula | C10H3F18I | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 94.3ºC | |
| Name | 1,1,1,2,2,3,3,4,4,7,7,8,8,9,9,10,10,10-octadecafluoro-5-iododecane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.902g/cm3 |
|---|---|
| Boiling Point | 85-85,5ºC 25mm |
| Molecular Formula | C10H3F18I |
| Molecular Weight | 592.00700 |
| Flash Point | 94.3ºC |
| Exact Mass | 591.89900 |
| LogP | 7.11650 |
| Index of Refraction | 1.332 |
| InChIKey | ZDRHSXVFEQIXGS-UHFFFAOYSA-N |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)CC(I)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| HS Code | 2903799090 |
|---|---|
| Summary | 2903799090 halogenated derivatives of acyclic hydrocarbons containing two or more different halogens。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| 5H,5H,6H,6H-octadecafluoro-5-iodo-decane |
| Bis(perfluorbutyl)-1,2-iodethan |
| 1-Iodo-1,2-bis(perfluoro-n-butyl)ethane |
| 5H,6H,6H-5-Iodoperfluorodecane |