4-acetoxy-3,5-dimethoxybenzaldehyde
Modify Date: 2025-08-26 10:39:51
4-acetoxy-3,5-dimethoxybenzaldehyde structure
|
Common Name | 4-acetoxy-3,5-dimethoxybenzaldehyde | ||
|---|---|---|---|---|
| CAS Number | 53669-33-3 | Molecular Weight | 224.21000 | |
| Density | 1.2g/cm3 | Boiling Point | 307.9ºC at 760 mmHg | |
| Molecular Formula | C11H12O5 | Melting Point | 115-117 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 152.3ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | (4-formyl-2,6-dimethoxyphenyl) acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2g/cm3 |
|---|---|
| Boiling Point | 307.9ºC at 760 mmHg |
| Melting Point | 115-117 °C(lit.) |
| Molecular Formula | C11H12O5 |
| Molecular Weight | 224.21000 |
| Flash Point | 152.3ºC |
| Exact Mass | 224.06800 |
| PSA | 61.83000 |
| LogP | 1.44160 |
| Index of Refraction | 1.53 |
| InChIKey | CSWKYHGBYCNZAS-UHFFFAOYSA-N |
| SMILES | COc1cc(C=O)cc(OC)c1OC(C)=O |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2915390090 |
| HS Code | 2915390090 |
|---|---|
| Summary | 2915390090. esters of acetic acid. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:5.5%. General tariff:30.0% |
| acetic acid 4-formyl-2,6-dimethoxy-phenyl ester |
| Syringaldehyde acetate |
| 4-formyl-2,6-dimethoxyphenyl acetate |
| O-acetylsyringaldehyde |
| 4-Acetoxy-3,5-dimethoxy-benzaldehyd |
| MFCD00016604 |
| 4-Acetoxy-3,5-dimethoxybenzaldehyde |