chlorophorin structure
|
Common Name | chlorophorin | ||
|---|---|---|---|---|
| CAS Number | 537-41-7 | Molecular Weight | 380.48 | |
| Density | 1.196g/cm3 | Boiling Point | 614ºC at 760mmHg | |
| Molecular Formula | C24H28O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 275.2ºC | |
Use of chlorophorinChlorophorin is a inhibitor of Melanocortin Receptor. Chlorophorin reduces tyrosinase activity and inhibits a-melanocyte-stimulating hormone-induced melanin production in B16F10 melanoma cells[1]. |
| Name | 5-[(E)-2-(2,4-dihydroxyphenyl)ethenyl]-2-[(2E)-3,7-dimethylocta-2,6-dienyl]benzene-1,3-diol |
|---|---|
| Synonym | More Synonyms |
| Description | Chlorophorin is a inhibitor of Melanocortin Receptor. Chlorophorin reduces tyrosinase activity and inhibits a-melanocyte-stimulating hormone-induced melanin production in B16F10 melanoma cells[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.196g/cm3 |
|---|---|
| Boiling Point | 614ºC at 760mmHg |
| Molecular Formula | C24H28O4 |
| Molecular Weight | 380.48 |
| Flash Point | 275.2ºC |
| Exact Mass | 380.19900 |
| PSA | 80.92000 |
| LogP | 5.91460 |
| Index of Refraction | 1.661 |
| InChIKey | OEILZVSHVTYHKL-MZYNZGBKSA-N |
| SMILES | CC(C)=CCCC(C)=CCc1c(O)cc(C=Cc2ccc(O)cc2O)cc1O |
| Precursor 0 | |
|---|---|
| DownStream 2 | |
| 1,3-Benzenediol,5-(2-(2,4-dihydroxyphenyl)ethenyl)-2-(3,7-dimethyl-2,6-octadienyl)-,(E,E) |
| Chlorophorin |