Butanedioic acid,2-methylene-, 1,4-bis(1-methylethyl) ester structure
|
Common Name | Butanedioic acid,2-methylene-, 1,4-bis(1-methylethyl) ester | ||
|---|---|---|---|---|
| CAS Number | 53720-10-8 | Molecular Weight | 214.25800 | |
| Density | 1.007g/cm3 | Boiling Point | 261.6ºC at 760mmHg | |
| Molecular Formula | C11H18O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 118.8ºC | |
| Name | dipropan-2-yl 2-methylidenebutanedioate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.007g/cm3 |
|---|---|
| Boiling Point | 261.6ºC at 760mmHg |
| Molecular Formula | C11H18O4 |
| Molecular Weight | 214.25800 |
| Flash Point | 118.8ºC |
| Exact Mass | 214.12100 |
| PSA | 52.60000 |
| LogP | 1.83590 |
| Index of Refraction | 1.439 |
| InChIKey | IJBBERPAEBYDJT-UHFFFAOYSA-N |
| SMILES | C=C(CC(=O)OC(C)C)C(=O)OC(C)C |
| Risk Phrases | 36/37/38 |
|---|---|
| Safety Phrases | 26-36/37/39 |
| HS Code | 2917190090 |
|
~10%
Butanedioic aci... CAS#:53720-10-8 |
| Literature: Kim, Youngju; Watanabe, Hidenori; Kim, Bieong-Kil; Seu, Young-Bae Tetrahedron Asymmetry, 2011 , vol. 22, # 16-17 p. 1658 - 1661 |
|
~%
Butanedioic aci... CAS#:53720-10-8 |
| Literature: Matsumoto, Akikazu; Watanabe, Hiroyuki; Otsu, Takayuki Bulletin of the Chemical Society of Japan, 1992 , vol. 65, # 3 p. 846 - 852 |
| HS Code | 2917190090 |
|---|---|
| Summary | 2917190090 acyclic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Butanedioic acid,2-methylene-,1,4-bis(1-methylethyl) ester |
| diisopropyl itaconate |
| Diisopropyl-itaconat |
| diisopropyl 2-methylidenebutanedioate |
| itaconic acid diisopropyl ester |