Spiro[1,3,2-benzodioxaphosphole-2,2-[1,3,2]dioxaphosphole], 2-phenoxy-4,5-bis (trifluoromethyl)- structure
|
Common Name | Spiro[1,3,2-benzodioxaphosphole-2,2-[1,3,2]dioxaphosphole], 2-phenoxy-4,5-bis (trifluoromethyl)- | ||
|---|---|---|---|---|
| CAS Number | 53799-42-1 | Molecular Weight | 426.20400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H9F6O5P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-phenoxy-4',5'-bis(trifluoromethyl)spiro[1,3,2λ5-benzodioxaphosphole-2,2'-1,3-dioxa-2λ5-phosphacyclopent-4-ene] |
|---|
| Molecular Formula | C16H9F6O5P |
|---|---|
| Molecular Weight | 426.20400 |
| Exact Mass | 426.00900 |
| PSA | 59.74000 |
| LogP | 6.04810 |
| InChIKey | RKMKMSLWIQPWRD-UHFFFAOYSA-N |
| SMILES | FC(F)(F)C1=C(C(F)(F)F)OP2(Oc3ccccc3)(O1)Oc1ccccc1O2 |
|
~%
Spiro[1,3,2-ben... CAS#:53799-42-1 |
| Literature: Ramirez,F. et al. Journal of the American Chemical Society, 1974 , vol. 96, p. 7269 - 7275 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |