1,1,1,4,4,4-Hexafluorobutane-2,3-dione structure
|
Common Name | 1,1,1,4,4,4-Hexafluorobutane-2,3-dione | ||
|---|---|---|---|---|
| CAS Number | 685-24-5 | Molecular Weight | 194.03200 | |
| Density | 1.6 | Boiling Point | 20ºC | |
| Molecular Formula | C4F6O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1,1,1,4,4,4-Hexafluorobutane-2,3-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.6 |
|---|---|
| Boiling Point | 20ºC |
| Molecular Formula | C4F6O2 |
| Molecular Weight | 194.03200 |
| Exact Mass | 193.98000 |
| PSA | 34.14000 |
| LogP | 1.24920 |
| Index of Refraction | 1.283 |
| InChIKey | ZMIDKLPSOSQFSX-UHFFFAOYSA-N |
| SMILES | O=C(C(=O)C(F)(F)F)C(F)(F)F |
| Risk Phrases | 36/37/38 |
|---|---|
| Safety Phrases | 26-36/37/39 |
| HS Code | 2914700090 |
| Precursor 9 | |
|---|---|
| DownStream 2 | |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| 1,1,1,4,4,4-hexafluoro-butane-2,3-dione |
| hexafluorodiacetyl |
| perfluorobiacetyl |
| 1,1,1,4,4,4-hexafluoro-2,3-butanedione |
| perfluorodiacetyl |
| 1,1,1,4,4,4-Hexaflurobutane-2,3-dione |
| perfluorobutanedione |