3,3-dimethyl-1-phenylhexane-1,5-dione structure
|
Common Name | 3,3-dimethyl-1-phenylhexane-1,5-dione | ||
|---|---|---|---|---|
| CAS Number | 53857-06-0 | Molecular Weight | 218.29200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H18O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3,3-dimethyl-1-phenylhexane-1,5-dione |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H18O2 |
|---|---|
| Molecular Weight | 218.29200 |
| Exact Mass | 218.13100 |
| PSA | 34.14000 |
| LogP | 3.26470 |
| InChIKey | TXZMQEBDURGHKQ-UHFFFAOYSA-N |
| SMILES | CC(=O)CC(C)(C)CC(=O)c1ccccc1 |
|
~%
3,3-dimethyl-1-... CAS#:53857-06-0 |
| Literature: Narasaka,K. et al. Bulletin of the Chemical Society of Japan, 1976 , vol. 49, p. 779 - 783 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 3,3-Dimethyl-1-phenyl-1,5-hexandion |
| 3,3-dimethyl-1-phenyl-1,5-hexanedione |
| 1,5-Hexanedione,3,3-dimethyl-1-phenyl |