1,5-bis[(4-chlorophenyl)methoxy]cyclooctane structure
|
Common Name | 1,5-bis[(4-chlorophenyl)methoxy]cyclooctane | ||
|---|---|---|---|---|
| CAS Number | 53860-19-8 | Molecular Weight | 393.34700 | |
| Density | 1.19g/cm3 | Boiling Point | 484.1ºC at 760 mmHg | |
| Molecular Formula | C22H26Cl2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 145.8ºC | |
| Name | 1,5-bis[(4-chlorophenyl)methoxy]cyclooctane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.19g/cm3 |
|---|---|
| Boiling Point | 484.1ºC at 760 mmHg |
| Molecular Formula | C22H26Cl2O2 |
| Molecular Weight | 393.34700 |
| Flash Point | 145.8ºC |
| Exact Mass | 392.13100 |
| PSA | 18.46000 |
| LogP | 6.81820 |
| Index of Refraction | 1.573 |
| InChIKey | NLBQNXGYYTVHKL-UHFFFAOYSA-N |
| SMILES | Clc1ccc(COC2CCCC(OCc3ccc(Cl)cc3)CCC2)cc1 |
|
~%
1,5-bis[(4-chlo... CAS#:53860-19-8 |
| Literature: Hall,I.H. et al. Journal of Medicinal Chemistry, 1974 , vol. 17, p. 1253 - 1257 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Cyclooctane,1,5-bis((4-chlorophenyl)methoxy)-,cis |
| cis-1,5-Bis-(4-chlorbenzyloxy)-cyclooctan |
| cis-1,5-Bis((4-chlorophenyl)methoxy)cyclooctane |
| 1,5-bis[(4-chlorobenzyl)oxy]cyclooctane |
| cis-1,5-Bis(p-chlorobenzyloxy)cyclooctane |