1-[3-(trifluoromethyl)phenyl]pyrrole structure
|
Common Name | 1-[3-(trifluoromethyl)phenyl]pyrrole | ||
|---|---|---|---|---|
| CAS Number | 53871-26-4 | Molecular Weight | 211.18300 | |
| Density | 1.18g/cm3 | Boiling Point | 247.5ºC at 760 mmHg | |
| Molecular Formula | C11H8F3N | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 103.5ºC | |
| Name | 1-[3-(trifluoromethyl)phenyl]pyrrole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.18g/cm3 |
|---|---|
| Boiling Point | 247.5ºC at 760 mmHg |
| Molecular Formula | C11H8F3N |
| Molecular Weight | 211.18300 |
| Flash Point | 103.5ºC |
| Exact Mass | 211.06100 |
| PSA | 4.93000 |
| LogP | 3.49610 |
| Index of Refraction | 1.5 |
| InChIKey | WEOYJGQSAGJWQH-UHFFFAOYSA-N |
| SMILES | FC(F)(F)c1cccc(-n2cccc2)c1 |
|
~88%
1-[3-(trifluoro... CAS#:53871-26-4 |
| Literature: Abid, Mohammed; Landge, Shainaz M.; Toeroek, Bela Organic Preparations and Procedures International, 2006 , vol. 38, # 5 p. 495 - 500 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 1-[3-(trifluoromethyl)phenyl]-1H-pyrrole |
| 1-<(3-trifluoromethyl)phenyl> [3-(trifluoromethyl)phenyl]pyrrole |
| HMS549E09 |
| 1-(3-trifluoromethyl-phenyl)-pyrrole |