Glycine,N-(3-nitrophenyl)-, methyl ester structure
|
Common Name | Glycine,N-(3-nitrophenyl)-, methyl ester | ||
|---|---|---|---|---|
| CAS Number | 5389-83-3 | Molecular Weight | 210.18700 | |
| Density | 1.336g/cm3 | Boiling Point | 336.8ºC at 760 mmHg | |
| Molecular Formula | C9H10N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 157.5ºC | |
| Name | N-Methoxycarbonylglycin-p-nitrophenylester |
|---|---|
| Synonym | More Synonyms |
| Density | 1.336g/cm3 |
|---|---|
| Boiling Point | 336.8ºC at 760 mmHg |
| Molecular Formula | C9H10N2O4 |
| Molecular Weight | 210.18700 |
| Flash Point | 157.5ºC |
| Exact Mass | 210.06400 |
| PSA | 84.15000 |
| LogP | 1.77590 |
| Index of Refraction | 1.595 |
| InChIKey | FYSBDPODOKCGKN-UHFFFAOYSA-N |
| SMILES | COC(=O)CNc1cccc([N+](=O)[O-])c1 |
| HS Code | 2922499990 |
|---|
|
~87%
Glycine,N-(3-ni... CAS#:5389-83-3 |
| Literature: Mjalli, Adnan M.M.; Polisetti, Dharma R.; Subramanian, Govindan; Quada, James C.; Yarragunta, Ravindra R.; Andrews, Robert C.; Xie, Rongyuan Patent: US2007/191385 A1, 2007 ; Location in patent: Page/Page column 92 ; US 20070191385 A1 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| p-Nitrophenylcarbomethoxyglycinate |
| 4-nitrophenyl n-(methoxycarbonyl)glycinate |
| Methoxycarbonylglycine 4-nitrophenyl ester |
| p-Nitrophenylcarbomethoxyglycinate (NPCMG) |
| N-Methoxycarbonylmethyl-m-nitroanilin |
| MC-Gly-NP |
| N-methoxycarbonylglycine p-nitrophenyl ester |
| (3-nitrophenylamino)-acetic acid methyl ester |
| Glycine,N-(methoxycarbonyl)-,4-nitrophenyl ester |