tributyl(3-methyl-2-butenyl)tin structure
|
Common Name | tributyl(3-methyl-2-butenyl)tin | ||
|---|---|---|---|---|
| CAS Number | 53911-92-5 | Molecular Weight | 359.16900 | |
| Density | 1.069 | Boiling Point | 283ºC | |
| Molecular Formula | C17H36Sn | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | >230 °F | |
| Symbol |
GHS06, GHS08, GHS09 |
Signal Word | Danger | |
| Name | tributyl(3-methyl-2-butenyl)tin |
|---|---|
| Synonym | More Synonyms |
| Density | 1.069 |
|---|---|
| Boiling Point | 283ºC |
| Molecular Formula | C17H36Sn |
| Molecular Weight | 359.16900 |
| Flash Point | >230 °F |
| Exact Mass | 360.18400 |
| LogP | 6.80170 |
| Appearance of Characters | Liquid | Clear colorless |
| Index of Refraction | n20/D 1.488(lit.) |
| InChIKey | XEFRYQPTIWSVGI-UHFFFAOYSA-N |
| SMILES | CCCC[Sn](CC=C(C)C)(CCCC)CCCC |
| Storage condition | Refrigerator (+4°C) |
| Water Solubility | Immiscible with water. |
| Symbol |
GHS06, GHS08, GHS09 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H301-H312-H315-H319-H372-H410 |
| Precautionary Statements | P273-P280-P301 + P310-P305 + P351 + P338-P314-P501 |
| Personal Protective Equipment | Eyeshields;Faceshields;full-face respirator (US);Gloves;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
| Hazard Codes | T:Toxic;N:Dangerousfortheenvironment; |
| Risk Phrases | R21;R25;R36/38;R48/23/25;R50/53 |
| Safety Phrases | S35-S36/37/39-S45-S60-S61 |
| RIDADR | UN 2788 6.1/PG 3 |
| WGK Germany | 3 |
| Packaging Group | II |
| Hazard Class | 6.1 |
| HS Code | 29312000 |
|
~%
tributyl(3-meth... CAS#:53911-92-5 |
| Literature: Organometallics, , vol. 13, p. 906 - 913 |
|
~0%
tributyl(3-meth... CAS#:53911-92-5 |
| Literature: Takuwa, Akio; Kanaue, Takashi; Yamashita, Koichi; Nishigaichi, Yutaka Journal of the Chemical Society - Perkin Transactions 1, 1998 , # 7 p. 1309 - 1314 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| Tributyl(3-methyl-2-butenyl)tin |
| Tri-n-butyl(3-methyl-2-butenyl)tin |
| MFCD01863649 |
| tributyl(3-methylbut-2-enyl)stannane |
| Tributyl(3-methylbut-2-en-1-yl)stannane |