7-Acetyl-5-oxo-5H-(1)benzopyra structure
|
Common Name | 7-Acetyl-5-oxo-5H-(1)benzopyra | ||
|---|---|---|---|---|
| CAS Number | 53944-40-4 | Molecular Weight | 239.22600 | |
| Density | 1.341g/cm3 | Boiling Point | 446.8ºC at 760mmHg | |
| Molecular Formula | C14H9NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 224ºC | |
Use of 7-Acetyl-5-oxo-5H-(1)benzopyraY 9000 is an orally active anti-allergic agent [1]. |
| Name | 7-acetylchromeno[2,3-b]pyridin-5-one |
|---|---|
| Synonym | More Synonyms |
| Description | Y 9000 is an orally active anti-allergic agent [1]. |
|---|---|
| Related Catalog | |
| References |
[1]. Maruyama Y, et al. Nihon Yakurigaku Zasshi. 1978;74(2):179-191. |
| Density | 1.341g/cm3 |
|---|---|
| Boiling Point | 446.8ºC at 760mmHg |
| Molecular Formula | C14H9NO3 |
| Molecular Weight | 239.22600 |
| Flash Point | 224ºC |
| Exact Mass | 239.05800 |
| PSA | 60.17000 |
| LogP | 2.54380 |
| Index of Refraction | 1.632 |
| InChIKey | ZYGDCOJTJFQANG-UHFFFAOYSA-N |
| SMILES | CC(=O)c1ccc2oc3ncccc3c(=O)c2c1 |
| HS Code | 2934999090 |
|---|
|
~%
7-Acetyl-5-oxo-... CAS#:53944-40-4 |
| Literature: Yoshitomi Pharmaceutical Industries, Ltd. Patent: US3931199 A1, 1976 ; |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Y-9000 |
| 5H-(1)Benzopyrano(2,3-b)pyridin-5-one,7-acetyl |
| 7-Acetyl-5-oxo-5H-(1)benzopyrano(2,3-b)pyridine |
| 7-Acetyl-5-oxo-5H-1-benzopyrano<2,3-b>pyridin |
| Ketone,methyl 5-oxo-5H-(1)benzopyrano(2,3-b)pyridyl |
| 7-acetyl-chromeno[2,3-b]pyridin-5-one |