Phenol,2-methoxy-4-(2-nitro-1-propen-1-yl)- structure
|
Common Name | Phenol,2-methoxy-4-(2-nitro-1-propen-1-yl)- | ||
|---|---|---|---|---|
| CAS Number | 5395-47-1 | Molecular Weight | 209.19900 | |
| Density | 1.264g/cm3 | Boiling Point | 349.8ºC at 760mmHg | |
| Molecular Formula | C10H11NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 165.4ºC | |
| Name | 2-Methoxy-4-(2-nitro-1-propenyl)phenol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.264g/cm3 |
|---|---|
| Boiling Point | 349.8ºC at 760mmHg |
| Molecular Formula | C10H11NO4 |
| Molecular Weight | 209.19900 |
| Flash Point | 165.4ºC |
| Exact Mass | 209.06900 |
| PSA | 75.28000 |
| LogP | 2.56150 |
| Index of Refraction | 1.599 |
| InChIKey | FDLWTEUMNRJFCS-ALCCZGGFSA-N |
| SMILES | COc1cc(C=C(C)[N+](=O)[O-])ccc1O |
|
~%
Phenol,2-methox... CAS#:5395-47-1 |
| Literature: Reis, Joana; Oliveira, Catarina; Milhazes, Nuno; Vina, Dolores; Borges, Fernanda Letters in Drug Design and Discovery, 2012 , vol. 9, # 10 p. 958 - 961 |
| 1-(4-hydroxy-3-methoxyphenyl)-2-nitropropene |