Pyridinium,1,1'-(1,2-ethanediyl)bis-, chloride (1:2)
Pyridinium,1,1'-(1,2-ethanediyl)bis-, chloride (1:2) structure
|
Common Name | Pyridinium,1,1'-(1,2-ethanediyl)bis-, chloride (1:2) | ||
|---|---|---|---|---|
| CAS Number | 53952-74-2 | Molecular Weight | 221.70600 | |
| Density | 0.985g/cm3 | Boiling Point | 313.5ºC at 760 mmHg | |
| Molecular Formula | C12H14ClN2+ | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 134.8ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-(2-pyridin-1-ium-1-ylethyl)pyridin-1-ium,chloride |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 0.985g/cm3 |
|---|---|
| Boiling Point | 313.5ºC at 760 mmHg |
| Molecular Formula | C12H14ClN2+ |
| Molecular Weight | 221.70600 |
| Flash Point | 134.8ºC |
| Exact Mass | 221.08500 |
| PSA | 7.76000 |
| Index of Refraction | 1.524 |
| InChIKey | ZQBOHHWTIGJGKE-UHFFFAOYSA-M |
| SMILES | [Cl-].c1cc[n+](CC[n+]2ccccc2)cc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~76%
Pyridinium,1,1'... CAS#:53952-74-2 |
| Literature: Zhao, Sanhu; Xu, Xiaoming; Zheng, Lu; Liu, Hai Ultrasonics Sonochemistry, 2010 , vol. 17, # 4 p. 685 - 689 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the boiling point of 1-(2-pyridin-1-ium-1-ylethyl)pyridin-1-ium,chloride? |
| A: Boiling point of 1-(2-pyridin-1-ium-1-ylethyl)pyridin-1-ium,chloride is 313.5ºC at 760 mmHg. |
| Q: What is the InChIKey of 1-(2-pyridin-1-ium-1-ylethyl)pyridin-1-ium,chloride? |
| A: InChIKey of 1-(2-pyridin-1-ium-1-ylethyl)pyridin-1-ium,chloride is ZQBOHHWTIGJGKE-UHFFFAOYSA-M. |
| Q: What is the polar surface area (PSA) of 1-(2-pyridin-1-ium-1-ylethyl)pyridin-1-ium,chloride? |
| A: Polar surface area (PSA) of 1-(2-pyridin-1-ium-1-ylethyl)pyridin-1-ium,chloride is 7.76000. |
| Q: What is the English name of 1-(2-pyridin-1-ium-1-ylethyl)pyridin-1-ium,chloride? |
| A: The English name of 1-(2-pyridin-1-ium-1-ylethyl)pyridin-1-ium,chloride is 1-(2-pyridin-1-ium-1-ylethyl)pyridin-1-ium,chloride. |
| Q: What is the molecular weight of 1-(2-pyridin-1-ium-1-ylethyl)pyridin-1-ium,chloride? |
| A: Molecular weight of 1-(2-pyridin-1-ium-1-ylethyl)pyridin-1-ium,chloride is 221.70600. |
| Q: What is the Chinese name of 53952-74-2? |
| A: Chinese name of 53952-74-2 is 53952-74-2. |
| Q: What is the SMILES notation of 1-(2-pyridin-1-ium-1-ylethyl)pyridin-1-ium,chloride? |
| A: SMILES notation of 1-(2-pyridin-1-ium-1-ylethyl)pyridin-1-ium,chloride is [Cl-].c1cc[n+](CC[n+]2ccccc2)cc1. |
| Q: What is the molecular formula of 1-(2-pyridin-1-ium-1-ylethyl)pyridin-1-ium,chloride? |
| A: Molecular formula of 1-(2-pyridin-1-ium-1-ylethyl)pyridin-1-ium,chloride is C12H14ClN2+. |
| Q: What is the CAS number of 1-(2-pyridin-1-ium-1-ylethyl)pyridin-1-ium,chloride? |
| A: CAS number of 1-(2-pyridin-1-ium-1-ylethyl)pyridin-1-ium,chloride is 53952-74-2. |
| Q: What are the upstream materials of 1-(2-pyridin-1-ium-1-ylethyl)pyridin-1-ium,chloride? |
| A: Related upstream materials(CAS) of 1-(2-pyridin-1-ium-1-ylethyl)pyridin-1-ium,chloride: 4185-69-7;107-15-3. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |