methyl 3-acetyloxy-2-bromo-3-(3,4-dimethoxyphenyl)propanoate structure
|
Common Name | methyl 3-acetyloxy-2-bromo-3-(3,4-dimethoxyphenyl)propanoate | ||
|---|---|---|---|---|
| CAS Number | 5396-69-0 | Molecular Weight | 361.18500 | |
| Density | 1.402g/cm3 | Boiling Point | 370.3ºC at 760 mmHg | |
| Molecular Formula | C14H17BrO6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 177.8ºC | |
| Name | 1H-Isoindol-1-one,3-(acetyloxy)-2,3-dihydro-2-(phenylmethyl) |
|---|---|
| Synonym | More Synonyms |
| Density | 1.402g/cm3 |
|---|---|
| Boiling Point | 370.3ºC at 760 mmHg |
| Molecular Formula | C14H17BrO6 |
| Molecular Weight | 361.18500 |
| Flash Point | 177.8ºC |
| Exact Mass | 360.02100 |
| PSA | 71.06000 |
| LogP | 2.24450 |
| Index of Refraction | 1.525 |
| InChIKey | QXFPBDSWSBVBSX-UHFFFAOYSA-N |
| SMILES | COC(=O)C(Br)C(OC(C)=O)c1ccc(OC)c(OC)c1 |
| HS Code | 2918990090 |
|---|
|
~%
methyl 3-acetyl... CAS#:5396-69-0 |
| Literature: Adler; Bjoerkqvist Acta Chemica Scandinavica (1947-1973), 1951 , vol. 5, p. 241,247 |
|
~%
methyl 3-acetyl... CAS#:5396-69-0 |
| Literature: Adler; Bjoerkqvist Acta Chemica Scandinavica (1947-1973), 1951 , vol. 5, p. 241,247 |
|
~%
methyl 3-acetyl... CAS#:5396-69-0 |
| Literature: Adler; Bjoerkqvist Acta Chemica Scandinavica (1947-1973), 1951 , vol. 5, p. 241,247 |
|
~%
methyl 3-acetyl... CAS#:5396-69-0 |
| Literature: Adler; Bjoerkqvist Acta Chemica Scandinavica (1947-1973), 1951 , vol. 5, p. 241,247 |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 3-acetoxy-2-bromo-3-(3,4-dimethoxy-phenyl)-propionic acid methyl ester |
| 3-Acetoxy-2-brom-3-(3,4-dimethoxy-phenyl)-propionsaeure-methylester |
| 3-acetoxy-2-benzylisoindolin-1-one |
| 2-benzyl-3-oxo-2,3-dihydro-1H-isoindol-1-yl acetate |