N,N,N,N-tetraethyl-5H-purine-2,6-diamine
Modify Date: 2025-09-01 17:47:40
N,N,N,N-tetraethyl-5H-purine-2,6-diamine structure
|
Common Name | N,N,N,N-tetraethyl-5H-purine-2,6-diamine | ||
|---|---|---|---|---|
| CAS Number | 5397-10-4 | Molecular Weight | 262.35400 | |
| Density | 1.18g/cm3 | Boiling Point | 355.5ºC at 760 mmHg | |
| Molecular Formula | C13H22N6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 168.8ºC | |
| Name | 2-N,2-N,6-N,6-N-tetraethyl-7H-purine-2,6-diamine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.18g/cm3 |
|---|---|
| Boiling Point | 355.5ºC at 760 mmHg |
| Molecular Formula | C13H22N6 |
| Molecular Weight | 262.35400 |
| Flash Point | 168.8ºC |
| Exact Mass | 262.19100 |
| PSA | 60.94000 |
| LogP | 2.04530 |
| Index of Refraction | 1.608 |
| InChIKey | DHXBQOAREDTWRP-UHFFFAOYSA-N |
| SMILES | CCN(CC)c1nc(N(CC)CC)c2[nH]cnc2n1 |
| HS Code | 2933990090 |
|---|
|
~%
N,N,N,N-tetraet... CAS#:5397-10-4 |
| Literature: Montgomery; Holum Journal of the American Chemical Society, 1958 , vol. 80, p. 404,408 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| N2,N2,N6,N6-tetraethyl-7(9)H-purine-2,6-diyldiamine |
| N2,N2,N6,N6-Tetraaethyl-7(9)H-purin-2,6-diyldiamin |
| N,N,N',N'-tetraethyl-7H-purine-2,6-diamine |