4-[(2-oxo-1,2-diphenyl-ethyl)amino]benzoic acid structure
|
Common Name | 4-[(2-oxo-1,2-diphenyl-ethyl)amino]benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 5397-55-7 | Molecular Weight | 331.36500 | |
| Density | 1.28g/cm3 | Boiling Point | 564.9ºC at 760 mmHg | |
| Molecular Formula | C21H17NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 295.4ºC | |
| Name | 4-[(2-oxo-1,2-diphenylethyl)amino]benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.28g/cm3 |
|---|---|
| Boiling Point | 564.9ºC at 760 mmHg |
| Molecular Formula | C21H17NO3 |
| Molecular Weight | 331.36500 |
| Flash Point | 295.4ºC |
| Exact Mass | 331.12100 |
| PSA | 66.40000 |
| LogP | 4.49390 |
| Index of Refraction | 1.671 |
| InChIKey | WBOWCSGYFWATPV-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccc(NC(C(=O)c2ccccc2)c2ccccc2)cc1 |
| HS Code | 2922509090 |
|---|
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| HMS3091A17 |
| 4-Desylamino-benzoesaeure |