DESYL BENZOATE structure
|
Common Name | DESYL BENZOATE | ||
|---|---|---|---|---|
| CAS Number | 1459-20-7 | Molecular Weight | 316.35000 | |
| Density | 1.195g/cm3 | Boiling Point | 499ºC at 760mmHg | |
| Molecular Formula | C21H16O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 220.5ºC | |
| Name | desyl benzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.195g/cm3 |
|---|---|
| Boiling Point | 499ºC at 760mmHg |
| Molecular Formula | C21H16O3 |
| Molecular Weight | 316.35000 |
| Flash Point | 220.5ºC |
| Exact Mass | 316.11000 |
| PSA | 43.37000 |
| LogP | 4.46760 |
| Vapour Pressure | 4.3E-10mmHg at 25°C |
| Index of Refraction | 1.612 |
| InChIKey | FGOSBCXOMBLILW-UHFFFAOYSA-N |
| SMILES | O=C(OC(C(=O)c1ccccc1)c1ccccc1)c1ccccc1 |
| Safety Phrases | S22-S24/25 |
|---|---|
| HS Code | 2916310090 |
| Precursor 10 | |
|---|---|
| DownStream 8 | |
| HS Code | 2916310090 |
|---|---|
| Summary | 2916310090 other benzoic acid and its salts and esters。supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward)。VAT:17.0%。tax rebate rate:9.0%。MFN tariff:6.5%。general tariff:30.0% |
| O-benzoylbenzoin |
| 2-Oxo-1,2-diphenylethyl benzoate |
| 1,2-diphenylethan-1-one-2-yl benzoate |
| benzoin benzoate |
| benzoic acid 2-oxo-1,2-diphenyl-ethyl ester |
| 1,2-diphenyl-2-oxoethyl benzoate |