(2-bromo-2-methyl-propyl)sulfonylbenzene structure
|
Common Name | (2-bromo-2-methyl-propyl)sulfonylbenzene | ||
|---|---|---|---|---|
| CAS Number | 5398-02-7 | Molecular Weight | 277.17800 | |
| Density | 1.429g/cm3 | Boiling Point | 378.4ºC at 760 mmHg | |
| Molecular Formula | C10H13BrO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 182.6ºC | |
| Name | (2-bromo-2-methylpropyl)sulfonylbenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.429g/cm3 |
|---|---|
| Boiling Point | 378.4ºC at 760 mmHg |
| Molecular Formula | C10H13BrO2S |
| Molecular Weight | 277.17800 |
| Flash Point | 182.6ºC |
| Exact Mass | 275.98200 |
| PSA | 42.52000 |
| LogP | 3.71460 |
| Index of Refraction | 1.55 |
| InChIKey | JOJVPMAKEOQWQX-UHFFFAOYSA-N |
| SMILES | CC(C)(Br)CS(=O)(=O)c1ccccc1 |
|
~71%
(2-bromo-2-meth... CAS#:5398-02-7 |
| Literature: Volta, Luca; Stirling, Charles J. M. Phosphorus, Sulfur and Silicon and the Related Elements, 2009 , vol. 184, # 6 p. 1508 - 1522 |
| [(2-bromo-2-methylpropyl)sulfonyl]benzene |
| 2-bromo-2-methyl-1-phenylsulfonylpropane |