2-methylprop-1-enylsulfonylbenzene
2-methylprop-1-enylsulfonylbenzene structure
|
Common Name | 2-methylprop-1-enylsulfonylbenzene | ||
|---|---|---|---|---|
| CAS Number | 54897-35-7 | Molecular Weight | 196.26600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H12O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: 2-methylprop-1-enylsulfonylbenzene (Chinese name: 2-甲基丙烯基苯磺酰基化合物, CAS number: 54897-35-7, molecular formula: C10H12O2S, molecular weight: 196.26600), For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-methylprop-1-enylsulfonylbenzene |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H12O2S |
|---|---|
| Molecular Weight | 196.26600 |
| Exact Mass | 196.05600 |
| PSA | 42.52000 |
| LogP | 3.46480 |
| InChIKey | ZQWVEGQLGDSMEA-UHFFFAOYSA-N |
| SMILES | CC(C)=CS(=O)(=O)c1ccccc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 9 | |
|---|---|
| DownStream 0 | |
![Trimethyl[(phenylsulfonyl)methyl]silane Structure](https://image.chemsrc.com/caspic/419/17872-92-3.png)
CAS#:17872-92-3
CAS#:67-64-1
CAS#:5398-02-7
CAS#:27998-51-2
CAS#:27998-71-6
CAS#:98-09-9
CAS#:2297-65-6
CAS#:128564-07-8
CAS#:49639-05-6This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Benzene,[(2-methyl-1-propenyl)sulfonyl] |
| 1-benzenesulfonyl 2-methyl-1-propene |
| 2-methyl-1-phenylsulfonyl-1-propene |
| 2-methyl-1-phenylsulfonylpropene |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 2-methylprop-1-enylsulfonylbenzene? |
| A: SMILES notation of 2-methylprop-1-enylsulfonylbenzene is CC(C)=CS(=O)(=O)c1ccccc1. |
| Q: What is the English name of 2-methylprop-1-enylsulfonylbenzene? |
| A: The English name of 2-methylprop-1-enylsulfonylbenzene is 2-methylprop-1-enylsulfonylbenzene. |
| Q: What is the LogP of 2-methylprop-1-enylsulfonylbenzene? |
| A: LogP of 2-methylprop-1-enylsulfonylbenzene is 3.46480. |
| Q: What are the upstream materials of 2-methylprop-1-enylsulfonylbenzene? |
| A: Related upstream materials(CAS) of 2-methylprop-1-enylsulfonylbenzene: 17872-92-3;67-64-1;5398-02-7;27998-51-2;27998-71-6;98-09-9;2297-65-6;128564-07-8;49639-05-6. |
| Q: What English synonyms does 2-methylprop-1-enylsulfonylbenzene have? |
| A: English synonyms of 2-methylprop-1-enylsulfonylbenzene: Benzene,[(2-methyl-1-propenyl)sulfonyl], 1-benzenesulfonyl 2-methyl-1-propene, 2-methyl-1-phenylsulfonyl-1-propene, 2-methyl-1-phenylsulfonylpropene. |
| Q: What is the molecular weight of 2-methylprop-1-enylsulfonylbenzene? |
| A: Molecular weight of 2-methylprop-1-enylsulfonylbenzene is 196.26600. |
| Q: What is the polar surface area (PSA) of 2-methylprop-1-enylsulfonylbenzene? |
| A: Polar surface area (PSA) of 2-methylprop-1-enylsulfonylbenzene is 42.52000. |
| Q: What is the CAS number of 2-methylprop-1-enylsulfonylbenzene? |
| A: CAS number of 2-methylprop-1-enylsulfonylbenzene is 54897-35-7. |
| Q: What is the molecular formula of 2-methylprop-1-enylsulfonylbenzene? |
| A: Molecular formula of 2-methylprop-1-enylsulfonylbenzene is C10H12O2S. |
| Q: What is the InChIKey of 2-methylprop-1-enylsulfonylbenzene? |
| A: InChIKey of 2-methylprop-1-enylsulfonylbenzene is ZQWVEGQLGDSMEA-UHFFFAOYSA-N. |