1-(2-methyl-4-oxo-pentan-2-yl)-3-phenyl-thiourea structure
|
Common Name | 1-(2-methyl-4-oxo-pentan-2-yl)-3-phenyl-thiourea | ||
|---|---|---|---|---|
| CAS Number | 5398-30-1 | Molecular Weight | 250.36000 | |
| Density | 1.143g/cm3 | Boiling Point | 364.9ºC at 760 mmHg | |
| Molecular Formula | C13H18N2OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 174.5ºC | |
| Name | 1-(2-methyl-4-oxopentan-2-yl)-3-phenylthiourea |
|---|---|
| Synonym | More Synonyms |
| Density | 1.143g/cm3 |
|---|---|
| Boiling Point | 364.9ºC at 760 mmHg |
| Molecular Formula | C13H18N2OS |
| Molecular Weight | 250.36000 |
| Flash Point | 174.5ºC |
| Exact Mass | 250.11400 |
| PSA | 73.22000 |
| LogP | 3.19460 |
| Index of Refraction | 1.596 |
| InChIKey | GRIDXEZRIAIPJM-UHFFFAOYSA-N |
| SMILES | CC(=O)CC(C)(C)NC(=S)Nc1ccccc1 |
|
~%
1-(2-methyl-4-o... CAS#:5398-30-1 |
| Literature: Singh, Harjit; Singh, Paramjit Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1980 , p. 1013 - 1018 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| N'-[(E)-1,1-dimethyl-3-oxobutyl]-N-phenylcarbamimidothioic acid |
| N-(1,1-Dimethyl-3-oxo-butyl)-N'-phenyl-thioharnstoff |
| N'-(2-methyl-4-oxopentan-2-yl)-N-phenyl-1-sulfanylmethanimidamide |
| 1-phenyl-4,4,6-trimethyl-1,4,5,6-tetrahydro-6-hydroxypyrimidine-2(3H)-thione |
| N-(1,1-dimethyl-3-oxo-butyl)-N'-phenyl-thiourea |