1,3-Dioxane,5-bromo-2-methyl-5-nitro- structure
|
Common Name | 1,3-Dioxane,5-bromo-2-methyl-5-nitro- | ||
|---|---|---|---|---|
| CAS Number | 53983-00-9 | Molecular Weight | 226.02500 | |
| Density | 1.7g/cm3 | Boiling Point | 280.3ºC at 760 mmHg | |
| Molecular Formula | C5H8BrNO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 123.3ºC | |
| Name | 5-bromo-2-methyl-5-nitro-1,3-dioxane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.7g/cm3 |
|---|---|
| Boiling Point | 280.3ºC at 760 mmHg |
| Molecular Formula | C5H8BrNO4 |
| Molecular Weight | 226.02500 |
| Flash Point | 123.3ºC |
| Exact Mass | 224.96400 |
| PSA | 64.28000 |
| LogP | 1.27030 |
| Index of Refraction | 1.521 |
| InChIKey | VFBSFSGHILWWIJ-UHFFFAOYSA-N |
| SMILES | CC1OCC(Br)([N+](=O)[O-])CO1 |
| HS Code | 2934999090 |
|---|
|
~84%
1,3-Dioxane,5-b... CAS#:53983-00-9 |
| Literature: Eli Lilly and Company Patent: US4025533 A1, 1977 ; |
| Precursor 2 | |
|---|---|
| DownStream 2 | |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Nibroxane (USAN/INN) |
| 2-Methyl-5-brom-5-nitro-1,3-dioxan |
| Caswell No. 116AA |
| Nibroxanum |
| 5-bromo-2-methyl-5-nitro-[1,3]dioxane |
| Nibroxano |
| 5-Bromo-2-methyl-5-nitro-m-dioxane |
| Nibroxanum [INN-Latin] |
| NIBROXANE |