3-(6-(trifluoromethyl)pyridine-3-yl)propanoic acid structure
|
Common Name | 3-(6-(trifluoromethyl)pyridine-3-yl)propanoic acid | ||
|---|---|---|---|---|
| CAS Number | 539855-70-4 | Molecular Weight | 219.161 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 296.5±35.0 °C at 760 mmHg | |
| Molecular Formula | C9H8F3NO2 | Melting Point | 94-98ºC | |
| MSDS | N/A | Flash Point | 133.1±25.9 °C | |
| Name | 3-[6-(Trifluoromethyl)pyridin-3-yl]propanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 296.5±35.0 °C at 760 mmHg |
| Melting Point | 94-98ºC |
| Molecular Formula | C9H8F3NO2 |
| Molecular Weight | 219.161 |
| Flash Point | 133.1±25.9 °C |
| Exact Mass | 219.050720 |
| PSA | 50.19000 |
| LogP | 1.32 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.475 |
| InChIKey | BMMLLDYJLFQFJS-UHFFFAOYSA-N |
| SMILES | O=C(O)CCc1ccc(C(F)(F)F)nc1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933399090 |
|
~%
3-(6-(trifluoro... CAS#:539855-70-4 |
| Literature: WO2005/118548 A1, ; Page/Page column 15 ; WO 2005/118548 A1 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3-Pyridinepropanoic acid, 6-(trifluoromethyl)- |
| 6-(Trifluoromethyl)-3-pyridinepropanoic acid |
| 3-[6-(Trifluoromethyl)-3-pyridinyl]propanoic acid |
| 3-[6-(Trifluoromethyl)pyridin-3-yl]propionic acid |
| 3-[6-(Trifluoromethyl)pyridin-3-yl]propanoic acid |
| T6NJ BXFFF E2VQ |
| 3-(6-(trifluoromethyl)pyridine-3-yl)propanoic acid |