7-Amino-3-chloro cephalosporanic acid structure
|
Common Name | 7-Amino-3-chloro cephalosporanic acid | ||
|---|---|---|---|---|
| CAS Number | 53994-69-7 | Molecular Weight | 234.660 | |
| Density | 1.81g/cm3 | Boiling Point | 498.9±45.0 °C at 760 mmHg | |
| Molecular Formula | C7H7ClN2O3S | Melting Point | >180°C (分解) | |
| MSDS | N/A | Flash Point | 255.5±28.7 °C | |
Use of 7-Amino-3-chloro cephalosporanic acid7-Amino-3-chloro cephalosporanic acid (7-ACCA) is an important intermediate for the synthesis of the second generation cephalosporins Cefaclor (HY-B0198)[1]. |
| Name | 7-Amino-3-chloro-3-cephem-4-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Description | 7-Amino-3-chloro cephalosporanic acid (7-ACCA) is an important intermediate for the synthesis of the second generation cephalosporins Cefaclor (HY-B0198)[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.81g/cm3 |
|---|---|
| Boiling Point | 498.9±45.0 °C at 760 mmHg |
| Melting Point | >180°C (分解) |
| Molecular Formula | C7H7ClN2O3S |
| Molecular Weight | 234.660 |
| Flash Point | 255.5±28.7 °C |
| Exact Mass | 233.986588 |
| PSA | 108.93000 |
| LogP | -0.80 |
| Vapour Pressure | 0.0±2.7 mmHg at 25°C |
| Index of Refraction | 1.735 |
| InChIKey | OQSAFIZCBAZPMY-AWFVSMACSA-N |
| SMILES | NC1C(=O)N2C(C(=O)O)=C(Cl)CSC12 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2934996000 |
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| HS Code | 2934996000 |
|---|---|
| Summary | 2934996000. VAT:17.0%. Tax rebate rate:9.0%. . MFN tariff:6.0%. General tariff:20.0% |
| 7-Amino-3-chlorocephalosporanic Acid |
| 5-Thia-1-azabicyclo[4.2.0]oct-2-en-7-aminium, 2-carboxy-3-chloro-8-oxo-, inner salt, (6R,7R)- |
| 3-Chloro-7-amino-3-cephem-4-carboxylic Acid |
| (6R-trans)-7-amino-3-chloro-8-oxo-5-Thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| MFCD03650764 |
| (6R,7R)-7-Ammonio-3-chloro-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| (6R,7R)-7-Amino-3-chloro-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic Acid |
| EINECS 258-907-4 |
| 7-ACCA |