2-(1,1,2,3,3,3-Hexafluoropropoxy)phenol structure
|
Common Name | 2-(1,1,2,3,3,3-Hexafluoropropoxy)phenol | ||
|---|---|---|---|---|
| CAS Number | 53998-00-8 | Molecular Weight | 260.13300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H6F6O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(1,1,2,3,3,3-Hexafluoropropoxy)phenol |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C9H6F6O2 |
|---|---|
| Molecular Weight | 260.13300 |
| Exact Mass | 260.02700 |
| PSA | 29.46000 |
| LogP | 3.26420 |
| Index of Refraction | 1.419 |
| InChIKey | ZRHUNWKSAYTSAM-UHFFFAOYSA-N |
| SMILES | Oc1ccccc1OC(F)(F)C(F)C(F)(F)F |
| HS Code | 2909500000 |
|---|
|
~39%
2-(1,1,2,3,3,3-... CAS#:53998-00-8
Detail
|
| Literature: Bayliff, Andrew E.; Bryce, Martin R.; Chambers, Richard D. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1987 , p. 763 - 768 |
| HS Code | 2909500000 |
|---|---|
| Summary | 2909500000 ether-phenols, ether-alcohol-phenols and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 2,6-BIS( |
| o-(1,1,2,3,3,3-hexafluoropropoxy)phenol |
| Phenol,2-(1,1,2,3,3,3-hexafluoropropoxy) |