2-[(4-acetylphenyl)iminomethyl]cyclohexan-1-one structure
|
Common Name | 2-[(4-acetylphenyl)iminomethyl]cyclohexan-1-one | ||
|---|---|---|---|---|
| CAS Number | 5401-32-1 | Molecular Weight | 243.30100 | |
| Density | 1.12g/cm3 | Boiling Point | 434.1ºC at 760 mmHg | |
| Molecular Formula | C15H17NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 179.2ºC | |
| Name | 2-[(4-acetylphenyl)iminomethyl]cyclohexan-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.12g/cm3 |
|---|---|
| Boiling Point | 434.1ºC at 760 mmHg |
| Molecular Formula | C15H17NO2 |
| Molecular Weight | 243.30100 |
| Flash Point | 179.2ºC |
| Exact Mass | 243.12600 |
| PSA | 46.50000 |
| LogP | 3.35080 |
| Index of Refraction | 1.574 |
| InChIKey | CIDVWWGFLIWJFN-UHFFFAOYSA-N |
| SMILES | CC(=O)c1ccc(N=CC2CCCCC2=O)cc1 |
|
~%
2-[(4-acetylphe... CAS#:5401-32-1 |
| Literature: Sargent; Small Journal of Organic Chemistry, 1954 , vol. 19, p. 1400,1405 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2-<4-Acetyl-phenyliminomethyl>-cyclohexanon |