Acetic acid,2-(3,5-dimethylphenoxy)- structure
|
Common Name | Acetic acid,2-(3,5-dimethylphenoxy)- | ||
|---|---|---|---|---|
| CAS Number | 5406-14-4 | Molecular Weight | 180.20000 | |
| Density | 1.146g/cm3 | Boiling Point | 320.5ºC at 760mmHg | |
| Molecular Formula | C10H12O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 126.8ºC | |
| Name | 2-(3,5-dimethylphenoxy)acetic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.146g/cm3 |
|---|---|
| Boiling Point | 320.5ºC at 760mmHg |
| Molecular Formula | C10H12O3 |
| Molecular Weight | 180.20000 |
| Flash Point | 126.8ºC |
| Exact Mass | 180.07900 |
| PSA | 46.53000 |
| LogP | 1.76680 |
| InChIKey | NIPZZANLNKBKIS-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1)OCC(=O)O)C |
| HS Code | 2918990090 |
|---|
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| O-(3.5-Dimethyl-phenyl)-glykolsaeure |
| 3,5-Xylyloxyacetic acid |
| O-[3.5]Xylyl-glykolsaeure |
| 2-(3,5-dimethylphenoxy)-acetic acid |
| (3,5-Dimethyl-phenoxy)-essigsaeure |
| 3,5-DIMETHYLPHENOXYACETIC ACID |