3-Oxazolidinamine,2-imino-N-[(5-nitro-2-furanyl)methylene]- structure
|
Common Name | 3-Oxazolidinamine,2-imino-N-[(5-nitro-2-furanyl)methylene]- | ||
|---|---|---|---|---|
| CAS Number | 5407-76-1 | Molecular Weight | 224.17400 | |
| Density | 1.65g/cm3 | Boiling Point | 327.5ºC at 760mmHg | |
| Molecular Formula | C8H8N4O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 151.9ºC | |
| Name | (E)-3-(((5-nitrofuran-2-yl)methylene)amino)oxazolidin-2-imine |
|---|
| Density | 1.65g/cm3 |
|---|---|
| Boiling Point | 327.5ºC at 760mmHg |
| Molecular Formula | C8H8N4O4 |
| Molecular Weight | 224.17400 |
| Flash Point | 151.9ºC |
| Exact Mass | 224.05500 |
| PSA | 107.64000 |
| LogP | 1.34950 |
| Index of Refraction | 1.69 |
| InChIKey | JDGUEERJNDLTTL-VRPAOUSYSA-N |
| SMILES | N=C1OCCN1N=Cc1ccc([N+](=O)[O-])o1 |
| HS Code | 2934999090 |
|---|
|
~%
3-Oxazolidinami... CAS#:5407-76-1 |
| Literature: Hayes et al. Journal of the American Chemical Society, 1955 , vol. 77, p. 2282 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |