4-Chloro-3-nitropyridine hydrochloride (1:1) structure
|
Common Name | 4-Chloro-3-nitropyridine hydrochloride (1:1) | ||
|---|---|---|---|---|
| CAS Number | 54079-68-4 | Molecular Weight | 195.003 | |
| Density | N/A | Boiling Point | 279.9ºC at 760mmHg | |
| Molecular Formula | C5H4Cl2N2O2 | Melting Point | 135-138°C | |
| MSDS | N/A | Flash Point | 123.1ºC | |
| Name | 4-Chloro-3-nitropyridine hydrochloride |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 279.9ºC at 760mmHg |
|---|---|
| Melting Point | 135-138°C |
| Molecular Formula | C5H4Cl2N2O2 |
| Molecular Weight | 195.003 |
| Flash Point | 123.1ºC |
| Exact Mass | 193.964981 |
| PSA | 58.71000 |
| LogP | 2.96840 |
| InChIKey | YTPDMOPPRVGKEW-UHFFFAOYSA-N |
| SMILES | Cl.O=[N+]([O-])c1cnccc1Cl |
| Hazard Codes | Xi |
|---|---|
| Risk Phrases | R20/21/22 |
| Safety Phrases | S26-S36/37/39 |
| RIDADR | 2811 |
| Packaging Group | III |
| HS Code | 2933399090 |
|
~83%
4-Chloro-3-nitr... CAS#:54079-68-4 |
| Literature: Dyall, Leonard K.; Wah, Wong Ming Australian Journal of Chemistry, 1985 , vol. 38, # 7 p. 1045 - 1059 |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4-chloro-3-nitropyridine,hydrochloride |
| 4-Chloro-3-nitropyridine hydrochloride (1:1) |
| Pyridine, 4-chloro-3-nitro-, hydrochloride (1:1) |
| MFCD02683026 |
| 4-Methyl-3-nitropyridine HCL |