1-chloro-4-[2-chloroethoxy-(4-chlorophenyl)methyl]benzene structure
|
Common Name | 1-chloro-4-[2-chloroethoxy-(4-chlorophenyl)methyl]benzene | ||
|---|---|---|---|---|
| CAS Number | 5409-90-5 | Molecular Weight | 315.62200 | |
| Density | 1.292g/cm3 | Boiling Point | 400.5ºC at 760 mmHg | |
| Molecular Formula | C15H13Cl3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 140.2ºC | |
| Name | 1-chloro-4-[2-chloroethoxy-(4-chlorophenyl)methyl]benzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.292g/cm3 |
|---|---|
| Boiling Point | 400.5ºC at 760 mmHg |
| Molecular Formula | C15H13Cl3O |
| Molecular Weight | 315.62200 |
| Flash Point | 140.2ºC |
| Exact Mass | 314.00300 |
| PSA | 9.23000 |
| LogP | 5.33820 |
| Index of Refraction | 1.579 |
| InChIKey | MOACHUYFVYEKBB-UHFFFAOYSA-N |
| SMILES | ClCCOC(c1ccc(Cl)cc1)c1ccc(Cl)cc1 |
|
~%
1-chloro-4-[2-c... CAS#:5409-90-5 |
| Literature: Kulka; Van Stryk Canadian Journal of Chemistry, 1955 , vol. 33, p. 1130,1135 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| wln: opggn2g2f |