4,4'-Dichlorobenzhydrol structure
|
Common Name | 4,4'-Dichlorobenzhydrol | ||
|---|---|---|---|---|
| CAS Number | 90-97-1 | Molecular Weight | 253.124 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 386.1±32.0 °C at 760 mmHg | |
| Molecular Formula | C13H10Cl2O | Melting Point | 91-95 °C | |
| MSDS | N/A | Flash Point | 145.5±19.1 °C | |
| Name | 4,4'-Dichlorobenzhydrol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 386.1±32.0 °C at 760 mmHg |
| Melting Point | 91-95 °C |
| Molecular Formula | C13H10Cl2O |
| Molecular Weight | 253.124 |
| Flash Point | 145.5±19.1 °C |
| Exact Mass | 252.010864 |
| PSA | 20.23000 |
| LogP | 3.93 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.618 |
| InChIKey | PHUYGURFBULKPA-UHFFFAOYSA-N |
| SMILES | OC(c1ccc(Cl)cc1)c1ccc(Cl)cc1 |
| Hazard Codes | Xn:Harmful; |
|---|---|
| Risk Phrases | R22;R36/37/38 |
| Safety Phrases | S37/39-S26 |
| HS Code | 2906299090 |
| Precursor 10 | |
|---|---|
| DownStream 9 | |
| HS Code | 2906299090 |
|---|---|
| Summary | 2906299090 other aromatic alcohols。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
| Bis(4-chlorophenyl)methanol |
| MFCD00000629 |
| 4,4'-Dichlorobenzhydrol |
| EINECS 202-029-6 |