1-chloro-4-[4-(4-chlorophenyl)sulfanylbutylsulfanyl]benzene structure
|
Common Name | 1-chloro-4-[4-(4-chlorophenyl)sulfanylbutylsulfanyl]benzene | ||
|---|---|---|---|---|
| CAS Number | 5409-96-1 | Molecular Weight | 343.33400 | |
| Density | 1.29g/cm3 | Boiling Point | 460.6ºC at 760 mmHg | |
| Molecular Formula | C16H16Cl2S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 213ºC | |
| Name | Benzene,1,1'-(1,4-diphenyl-1,2,3-butatriene-1,4-diyl)bis[4-chloro |
|---|---|
| Synonym | More Synonyms |
| Density | 1.29g/cm3 |
|---|---|
| Boiling Point | 460.6ºC at 760 mmHg |
| Molecular Formula | C16H16Cl2S2 |
| Molecular Weight | 343.33400 |
| Flash Point | 213ºC |
| Exact Mass | 342.00700 |
| PSA | 50.60000 |
| LogP | 6.65800 |
| Index of Refraction | 1.638 |
| InChIKey | BQIXZVKTIWEDJR-UHFFFAOYSA-N |
| SMILES | Clc1ccc(SCCCCSc2ccc(Cl)cc2)cc1 |
|
~93%
1-chloro-4-[4-(... CAS#:5409-96-1 |
| Literature: Ranu, Brindaban C.; Jana, Ranjan Advanced Synthesis and Catalysis, 2005 , vol. 347, # 14 p. 1811 - 1818 |
|
~%
1-chloro-4-[4-(... CAS#:5409-96-1 |
| Literature: Baliah, V.; Aparajithan, K. Journal of the Indian Chemical Society, 1992 , vol. 69, # 5 p. 255 - 259 |
|
~%
1-chloro-4-[4-(... CAS#:5409-96-1 |
| Literature: Kulka; Van Stryk Canadian Journal of Chemistry, 1957 , vol. 35, p. 519,521 |
| Precursor 4 | |
|---|---|
| DownStream 0 | |
| 1,4-Di-(4-chlor-phenyl)-1,4-diphenyl-butatrien |
| 1,4-Bis-(4-chlor-phenylmercapto)-butan |
| 1,4-bis-(4-chloro-phenylsulfanyl)-butane |
| 1,4-Bis-(4-chlor-phenyl)-1,4-diphenyl-butatrien |
| 1,4-bis-(4-chloro-phenyl)-1,4-diphenyl-butatriene |