[4-(2-bromoacetyl)phenyl]arsonic acid structure
|
Common Name | [4-(2-bromoacetyl)phenyl]arsonic acid | ||
|---|---|---|---|---|
| CAS Number | 5410-40-2 | Molecular Weight | 322.97200 | |
| Density | N/A | Boiling Point | 541.5ºC at 760 mmHg | |
| Molecular Formula | C8H8AsBrO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 281.3ºC | |
| Name | (4-bromoacetyl-phenyl)-arsonic acid |
|---|
| Boiling Point | 541.5ºC at 760 mmHg |
|---|---|
| Molecular Formula | C8H8AsBrO4 |
| Molecular Weight | 322.97200 |
| Flash Point | 281.3ºC |
| Exact Mass | 321.88200 |
| PSA | 74.60000 |
| InChIKey | ATFLUIPKUPQEIU-UHFFFAOYSA-N |
| SMILES | O=C(CBr)c1ccc([As](=O)(O)O)cc1 |
|
~%
[4-(2-bromoacet... CAS#:5410-40-2 |
| Literature: Elson; Gibson Journal of the Chemical Society, 1931 , p. 2381,2386 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |