2-(4-arsonophenyl)acetic acid structure
|
Common Name | 2-(4-arsonophenyl)acetic acid | ||
|---|---|---|---|---|
| CAS Number | 5410-43-5 | Molecular Weight | 260.07600 | |
| Density | N/A | Boiling Point | 570.1ºC at 760 mmHg | |
| Molecular Formula | C8H9AsO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 312.7ºC | |
| Name | (4-arsono-phenyl)-acetic acid |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 570.1ºC at 760 mmHg |
|---|---|
| Molecular Formula | C8H9AsO5 |
| Molecular Weight | 260.07600 |
| Flash Point | 312.7ºC |
| Exact Mass | 259.96700 |
| PSA | 94.83000 |
| InChIKey | ALACQTQYQUMBES-UHFFFAOYSA-N |
| SMILES | O=C(O)Cc1ccc([As](=O)(O)O)cc1 |
|
~%
2-(4-arsonophen... CAS#:5410-43-5 |
| Literature: Doak et al. Journal of the American Chemical Society, 1940 , vol. 62, p. 3012 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| (4-Arsono-phenyl)-essigsaeure |
| Phenylessigsaeure-arsonsaeure-(4) |
| 4-Carboxymethylmercapto-benzo<g>chinazolin |
| Acetic acid,(benzo[g]quinazolin-5-ylthio) |
| 4-Carboxymethyl-phenylarsonsaeure |