2-[(4-arsonophenyl)amino]acetic acid structure
|
Common Name | 2-[(4-arsonophenyl)amino]acetic acid | ||
|---|---|---|---|---|
| CAS Number | 5410-45-7 | Molecular Weight | 275.09000 | |
| Density | N/A | Boiling Point | 662.9ºC at 760 mmHg | |
| Molecular Formula | C8H10AsNO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 354.7ºC | |
| Name | N-(4-arsono-phenyl)-glycine |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 662.9ºC at 760 mmHg |
|---|---|
| Molecular Formula | C8H10AsNO5 |
| Molecular Weight | 275.09000 |
| Flash Point | 354.7ºC |
| Exact Mass | 274.97700 |
| PSA | 106.86000 |
| InChIKey | XJHGBVCKYYNIPE-UHFFFAOYSA-N |
| SMILES | O=C(O)CNc1ccc([As](=O)(O)O)cc1 |
| HS Code | 2931900090 |
|---|
|
~%
2-[(4-arsonophe... CAS#:5410-45-7 |
| Literature: Hoechster Farbw. Patent: DE204664 ; |
|
~%
2-[(4-arsonophe... CAS#:5410-45-7 |
| Literature: Hoechster Farbw. Patent: DE204664 ; |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| 4-Carboxymethylamino-phenylarsonsaeure |