(4-methoxy-3-nitro-phenyl)-arsenic oxide structure
|
Common Name | (4-methoxy-3-nitro-phenyl)-arsenic oxide | ||
|---|---|---|---|---|
| CAS Number | 5410-85-5 | Molecular Weight | 244.05600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C7H7AsNO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (4-methoxy-3-nitro-phenyl)-arsenic oxide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C7H7AsNO4 |
|---|---|
| Molecular Weight | 244.05600 |
| Exact Mass | 243.95900 |
| PSA | 72.12000 |
| LogP | 0.91410 |
| InChIKey | SMFDUQPULPMANJ-UHFFFAOYSA-N |
| SMILES | COc1ccc([As]=O)cc1[N+](=O)[O-] |
|
~%
(4-methoxy-3-ni... CAS#:5410-85-5 |
| Literature: Doak; Steinman; Eagle Journal of the American Chemical Society, 1941 , vol. 63, p. 99 |
| 2-Nitro-4-arsenoso-anisol |