2-(4-chloro-5-methyl-2-propan-2-yl-phenoxy)acetic acid structure
|
Common Name | 2-(4-chloro-5-methyl-2-propan-2-yl-phenoxy)acetic acid | ||
|---|---|---|---|---|
| CAS Number | 5411-11-0 | Molecular Weight | 242.69900 | |
| Density | 1.196g/cm3 | Boiling Point | 364.8ºC at 760 mmHg | |
| Molecular Formula | C12H15ClO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 174.5ºC | |
| Name | 2-(4-chloro-5-methyl-2-propan-2-ylphenoxy)acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.196g/cm3 |
|---|---|
| Boiling Point | 364.8ºC at 760 mmHg |
| Molecular Formula | C12H15ClO3 |
| Molecular Weight | 242.69900 |
| Flash Point | 174.5ºC |
| Exact Mass | 242.07100 |
| PSA | 46.53000 |
| LogP | 3.23520 |
| InChIKey | MOUGPRIBEJMFGP-UHFFFAOYSA-N |
| SMILES | Cc1cc(OCC(=O)O)c(C(C)C)cc1Cl |
| HS Code | 2918990090 |
|---|
|
~%
2-(4-chloro-5-m... CAS#:5411-11-0 |
| Literature: Ettel et al. Collection of Czechoslovak Chemical Communications, 1950 , vol. 15, p. 1050,1064 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| butanedioic acid,2-sulfo-,1,4-didecyl ester |