trimethyl-[(3-nitrophenyl)methyl]azanium structure
|
Common Name | trimethyl-[(3-nitrophenyl)methyl]azanium | ||
|---|---|---|---|---|
| CAS Number | 5411-74-5 | Molecular Weight | 230.69100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H15ClN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | trimethyl-[(3-nitrophenyl)methyl]azanium,chloride |
|---|
| Molecular Formula | C10H15ClN2O2 |
|---|---|
| Molecular Weight | 230.69100 |
| Exact Mass | 230.08200 |
| PSA | 45.82000 |
| InChIKey | PUGVGJFXSXRJQA-UHFFFAOYSA-M |
| SMILES | C[N+](C)(C)Cc1cccc([N+](=O)[O-])c1.[Cl-] |
|
~%
trimethyl-[(3-n... CAS#:5411-74-5 |
| Literature: Ing; Robinson Journal of the Chemical Society, 1926 , p. 1665 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |