3-Nitrobenzyl chloride structure
|
Common Name | 3-Nitrobenzyl chloride | ||
|---|---|---|---|---|
| CAS Number | 619-23-8 | Molecular Weight | 171.58100 | |
| Density | 1503 | Boiling Point | 85-87 °C5 mm Hg(lit.) | |
| Molecular Formula | C7H6ClNO2 | Melting Point | 43-47 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | >230 °F | |
| Symbol |
GHS05 |
Signal Word | Danger | |
| Name | 3-Nitrobenzyl chloride |
|---|---|
| Synonym | More Synonyms |
| Density | 1503 |
|---|---|
| Boiling Point | 85-87 °C5 mm Hg(lit.) |
| Melting Point | 43-47 °C(lit.) |
| Molecular Formula | C7H6ClNO2 |
| Molecular Weight | 171.58100 |
| Flash Point | >230 °F |
| Exact Mass | 171.00900 |
| PSA | 45.82000 |
| LogP | 2.85680 |
| Index of Refraction | 1.5577 (62ºC) |
| InChIKey | APGGSERFJKEWFG-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cccc(CCl)c1 |
| Water Solubility | <0.1 g/100 mL at 22 ºC |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATAMUTATION DATA
|
| Symbol |
GHS05 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H314 |
| Precautionary Statements | P280-P305 + P351 + P338-P310 |
| Personal Protective Equipment | Eyeshields;Faceshields;full-face particle respirator type N100 (US);Gloves;respirator cartridge type N100 (US);type P1 (EN143) respirator filter;type P3 (EN 143) respirator cartridges |
| Hazard Codes | C:Corrosive; |
| Risk Phrases | R34 |
| Safety Phrases | S26-S36/37/39-S45 |
| RIDADR | UN 3261 8/PG 2 |
| WGK Germany | 3 |
| RTECS | XS9090000 |
| Packaging Group | II |
| Hazard Class | 8 |
| HS Code | 2904909090 |
| HS Code | 2904909090 |
|---|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
|
Benzodiazepine receptor binding activity of 8-substituted-9-(3-substituted-benzyl)-6-(dimethylamino)-9H-purines.
J. Med. Chem. 33(1) , 196-202, (1990) A series of 8-substituted analogues of 9-(3-aminobenzyl)-6-(dimethylamino)-9H-purine (8) were synthesized and tested for their ability to bind to the benzodiazepine receptor (BZR) in rat brain tissue.... |
|
|
Solvent effects on the reduction mechanism of 3-chloroanthracene, 3-nitrobenzyl chloride and 3-chloroacetophenone. Jensen H and Daasbjerg K
Acta Chir. Scand. Suppl. 58 , 1151-64, (1998)
|
| MFCD00007272 |
| 1-(chloromethyl)-3-nitrobenzene |
| EINECS 210-586-1 |