Pirozadil structure
|
Common Name | Pirozadil | ||
|---|---|---|---|---|
| CAS Number | 54110-25-7 | Molecular Weight | 527.52000 | |
| Density | 1.244g/cm3 | Boiling Point | 594ºC at 760mmHg | |
| Molecular Formula | C27H29NO10 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 313ºC | |
Use of PirozadilPirozadil is a hypolipidemic agent. |
| Name | [6-[(3,4,5-trimethoxybenzoyl)oxymethyl]pyridin-2-yl]methyl 3,4,5-trimethoxybenzoate |
|---|---|
| Synonym | More Synonyms |
| Description | Pirozadil is a hypolipidemic agent. |
|---|---|
| Related Catalog | |
| In Vivo | Pirozadil is a hypolipidemic agent. Pirozadil's effect on increasing cerebral blood flow is almost equal to that of papaverine, less than that of nicardipine and much greater than that of the other hypolipidemic/antiatherogenic drugs, nicotinic acid and pyridinol carbamate. Pirozadil is also shown to significantly diminish vascular cerebral resistance to a much greater degree than nicotinic acid and pyridinol carbamate[1]. |
| References |
| Density | 1.244g/cm3 |
|---|---|
| Boiling Point | 594ºC at 760mmHg |
| Molecular Formula | C27H29NO10 |
| Molecular Weight | 527.52000 |
| Flash Point | 313ºC |
| Exact Mass | 527.17900 |
| PSA | 120.87000 |
| LogP | 3.84720 |
| Index of Refraction | 1.559 |
| InChIKey | DIIBXMIIOQXTHW-UHFFFAOYSA-N |
| SMILES | COc1cc(C(=O)OCc2cccc(COC(=O)c3cc(OC)c(OC)c(OC)c3)n2)cc(OC)c1OC |
| Storage condition | 2-8℃ |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2,6-Pyridinediyldimethylene bis(3,4,5-trimethoxybenzoate) |
| 2,6-Pyridinediylbis(methylene) 3,4,5-trimethoxybenzoate |
| Benzoic acid,3,4,5-trimethoxy-,2,6-pyridinediylbis(methylene) ester |
| EINECS 258-978-1 |
| Pirozadil |
| 722 d |
| Pirozadilum [INN-Latin] |
| Pemix |
| 2,6-Pyridinedimethanol bis(3,4,5-trimethoxybenzoate) |