diethyl 2-(1-phenylethyl)butanedioate structure
|
Common Name | diethyl 2-(1-phenylethyl)butanedioate | ||
|---|---|---|---|---|
| CAS Number | 5415-32-7 | Molecular Weight | 278.34300 | |
| Density | 1.06g/cm3 | Boiling Point | 361.5ºC at 760 mmHg | |
| Molecular Formula | C16H22O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 172.1ºC | |
| Name | diethyl 2-(1-phenylethyl)butanedioate |
|---|
| Density | 1.06g/cm3 |
|---|---|
| Boiling Point | 361.5ºC at 760 mmHg |
| Molecular Formula | C16H22O4 |
| Molecular Weight | 278.34300 |
| Flash Point | 172.1ºC |
| Exact Mass | 278.15200 |
| PSA | 52.60000 |
| LogP | 2.92260 |
| Index of Refraction | 1.493 |
| InChIKey | BTHLADPOUNSKFX-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CC(C(=O)OCC)C(C)c1ccccc1 |
| HS Code | 2917399090 |
|---|
| HS Code | 2917399090 |
|---|---|
| Summary | 2917399090 aromatic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |