Diethyl 3-(benzyloxy)cyclobutane-1,1-dicarboxylate structure
|
Common Name | Diethyl 3-(benzyloxy)cyclobutane-1,1-dicarboxylate | ||
|---|---|---|---|---|
| CAS Number | 54166-15-3 | Molecular Weight | 306.354 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 368.3±42.0 °C at 760 mmHg | |
| Molecular Formula | C17H22O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 158.2±27.9 °C | |
| Name | diethyl 3-phenylmethoxycyclobutane-1,1-dicarboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 368.3±42.0 °C at 760 mmHg |
| Molecular Formula | C17H22O5 |
| Molecular Weight | 306.354 |
| Flash Point | 158.2±27.9 °C |
| Exact Mass | 306.146729 |
| PSA | 61.83000 |
| LogP | 3.57 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.524 |
| InChIKey | OSQKNXLJUGYQHW-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1(C(=O)OCC)CC(OCc2ccccc2)C1 |
| HS Code | 2918990090 |
|---|
|
~48%
Diethyl 3-(benz... CAS#:54166-15-3 |
| Literature: Nippon Shoji Kaisha Ltd. Patent: US6080750 A1, 2000 ; |
|
~73%
Diethyl 3-(benz... CAS#:54166-15-3 |
| Literature: INCYTE CORPORATION Patent: US2009/233903 A1, 2009 ; Location in patent: Page/Page column 40-41 ; US 20090233903 A1 |
|
~%
Diethyl 3-(benz... CAS#:54166-15-3 |
| Literature: WO2007/62332 A2, ; Page/Page column 16 ; |
|
~%
Diethyl 3-(benz... CAS#:54166-15-3 |
| Literature: Chemische Berichte, , vol. 90, p. 1424,1427 |
|
~%
Diethyl 3-(benz... CAS#:54166-15-3 |
| Literature: Chemische Berichte, , vol. 95, p. 2535,2540 |
| Precursor 5 | |
|---|---|
| DownStream 10 | |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| diethyl 3-(benzyloxy)cyclobutane-1,1-dicarboxylate |
| 3-Benzyloxy-cyclobutan-1,1-dicarbonsaeure-diaethylester |
| diethylester of 3-benzyloxycyclobutane-1,1-dicarboxylic acid |
| Diethyl 3-benzyloxy-1,1-cyclobutanedicarboxylate |
| 1,1-Cyclobutanedicarboxylic acid, 3-(phenylmethoxy)-, diethyl ester |
| Diethyl 3-(benzyloxy)-1,1-cyclobutanedicarboxylate |
| 1-Benzyloxy-3,3-bis-carbethoxy-cyclobutane |
| 3-Benzyloxy cyclobutane-1,1-dicarboxylic acid diethyl ester |