Propanedioicacid, 2-[(2-phenylhydrazinylidene)methyl]-, 1,3-diethyl ester structure
|
Common Name | Propanedioicacid, 2-[(2-phenylhydrazinylidene)methyl]-, 1,3-diethyl ester | ||
|---|---|---|---|---|
| CAS Number | 5418-02-0 | Molecular Weight | 278.30400 | |
| Density | 1.13g/cm3 | Boiling Point | 395.6ºC at 760mmHg | |
| Molecular Formula | C14H18N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 193ºC | |
| Name | diethyl 2-[(phenylhydrazinylidene)methyl]propanedioate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.13g/cm3 |
|---|---|
| Boiling Point | 395.6ºC at 760mmHg |
| Molecular Formula | C14H18N2O4 |
| Molecular Weight | 278.30400 |
| Flash Point | 193ºC |
| Exact Mass | 278.12700 |
| PSA | 76.99000 |
| LogP | 1.89970 |
| Index of Refraction | 1.522 |
| InChIKey | QCOKKGKRWMNXRP-XNTDXEJSSA-N |
| SMILES | CCOC(=O)C(C=NNc1ccccc1)C(=O)OCC |
| HS Code | 2928000090 |
|---|
|
~%
Propanedioicaci... CAS#:5418-02-0 |
| Literature: Claisen; Haase Chemische Berichte, vol. 28, p. 36 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2928000090 |
|---|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| 2-phenylhydrazonomalonyl dichloride |
| Formylmalonsaeure-diaethylester-phenylhydrazon |
| mesoxaloyl dichloride phenylhydrazone |