2,4,6-Tris(pentabromophenoxy)-1,3,5-triazine structure
|
Common Name | 2,4,6-Tris(pentabromophenoxy)-1,3,5-triazine | ||
|---|---|---|---|---|
| CAS Number | 54203-05-3 | Molecular Weight | 1540.80000 | |
| Density | 2.942g/cm3 | Boiling Point | 971.2ºC at 760 mmHg | |
| Molecular Formula | C21Br15N3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 541.2ºC | |
| Name | 2,4,6-tris(2,3,4,5,6-pentabromophenoxy)-1,3,5-triazine |
|---|---|
| Synonym | More Synonyms |
| Density | 2.942g/cm3 |
|---|---|
| Boiling Point | 971.2ºC at 760 mmHg |
| Molecular Formula | C21Br15N3O3 |
| Molecular Weight | 1540.80000 |
| Flash Point | 541.2ºC |
| Exact Mass | 1525.77000 |
| PSA | 66.36000 |
| LogP | 16.68600 |
| Index of Refraction | 1.758 |
| InChIKey | KDBOHDQAKNYHRC-UHFFFAOYSA-N |
| SMILES | Brc1c(Br)c(Br)c(Oc2nc(Oc3c(Br)c(Br)c(Br)c(Br)c3Br)nc(Oc3c(Br)c(Br)c(Br)c(Br)c3Br)n2)c(Br)c1Br |
| HS Code | 2933699090 |
|---|
| HS Code | 2933699090 |
|---|---|
| Summary | 2933699090 other compounds containing an unfused triazine ring (whether or not hydrogenated) in the structure。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:20.0% |
| 1,3,5-Triazine,2,4,6-tris(pentabromophenoxy) |
| 2,4,6-Tris(pentabromophenoxy)-1,3,5-triazine |
| 1,3,5-Triazine,2,4,6-tris(2,3,4,5,6-pentabromophenoxy) |
| 2,4,6-Tris(pentabromophenoxy)-s-triazine |