2,4,6-tris(dibromomethyl)-1,3,5-triazine structure
|
Common Name | 2,4,6-tris(dibromomethyl)-1,3,5-triazine | ||
|---|---|---|---|---|
| CAS Number | 30362-01-7 | Molecular Weight | 596.53200 | |
| Density | 2.992g/cm3 | Boiling Point | 475.3ºC at 760mmHg | |
| Molecular Formula | C6H3Br6N3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 241.2ºC | |
| Name | 2,4,6-tris(dibromomethyl)-1,3,5-triazine |
|---|---|
| Synonym | More Synonyms |
| Density | 2.992g/cm3 |
|---|---|
| Boiling Point | 475.3ºC at 760mmHg |
| Molecular Formula | C6H3Br6N3 |
| Molecular Weight | 596.53200 |
| Flash Point | 241.2ºC |
| Exact Mass | 590.54300 |
| PSA | 38.67000 |
| LogP | 5.23680 |
| Index of Refraction | 1.755 |
| InChIKey | CCZNFGBAORROPB-UHFFFAOYSA-N |
| SMILES | BrC(Br)c1nc(C(Br)Br)nc(C(Br)Br)n1 |
|
~53%
2,4,6-tris(dibr... CAS#:30362-01-7 |
| Literature: Sumera, F.; Rouzic, A. Le; Raphalen, D.; Kerfanto, M. Journal of Heterocyclic Chemistry, 1987 , vol. 24, p. 793 - 795 |
|
~%
2,4,6-tris(dibr... CAS#:30362-01-7 |
| Literature: Schaefer,F.C.; Ross,J.H. Journal of Organic Chemistry, 1964 , vol. 29, p. 1527 - 1537 |
|
~%
2,4,6-tris(dibr... CAS#:30362-01-7 |
| Literature: Ghigi Gazzetta Chimica Italiana, 1941 , vol. 71, p. 643 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 2,4,6-Tris-<dibrommethyl>-s-triazin |
| tris-dibromomethyl s-triazine |